C16H22N6OS — CID 146125582
1-[1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)ethyl]-3-(5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-2-yl)urea (PubChem CID 146125582) has the molecular formula C16H22N6OS and a molecular weight of 346.46 g/mol. Its IUPAC name is 1-[1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)ethyl]-3-(5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-2-yl)urea.
| Compound Name | 1-[1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)ethyl]-3-(5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-2-yl)urea |
|---|---|
| PubChem CID | 146125582 |
| Molecular Formula | C16H22N6OS |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 1-[1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)ethyl]-3-(5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-2-yl)urea |
| SMILES | CC(NC(=O)Nc1nc2c(s1)CCCCC2)c1nnc2n1CCC2 |
| InChI | InChI=1S/C16H22N6OS/c1-10(14-21-20-13-8-5-9-22(13)14)17-15(23)19-16-18-11-6-3-2-4-7-12(11)24-16/h10H,2-9H2,1H3,(H2,17,18,19,23) |
| InChIKey | GYCHHPGAZSJPHF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |