C15H17N7OS — CID 146125853
6-[1-[5-(3,4-dimethylphenyl)-1,3,4-oxadiazol-2-yl]ethylsulfanyl]-1,3,5-triazine-2,4-diamine (PubChem CID 146125853) has the molecular formula C15H17N7OS and a molecular weight of 343.42 g/mol. Its IUPAC name is 6-[1-[5-(3,4-dimethylphenyl)-1,3,4-oxadiazol-2-yl]ethylsulfanyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[1-[5-(3,4-dimethylphenyl)-1,3,4-oxadiazol-2-yl]ethylsulfanyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 146125853 |
| Molecular Formula | C15H17N7OS |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 6-[1-[5-(3,4-dimethylphenyl)-1,3,4-oxadiazol-2-yl]ethylsulfanyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc(-c2nnc(C(C)Sc3nc(N)nc(N)n3)o2)cc1C |
| InChI | InChI=1S/C15H17N7OS/c1-7-4-5-10(6-8(7)2)12-22-21-11(23-12)9(3)24-15-19-13(16)18-14(17)20-15/h4-6,9H,1-3H3,(H4,16,17,18,19,20) |
| InChIKey | SUWRXSQCFLJCQD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 129.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |