C13H15BrN2O — CID 62856515
2-(1-bromopropyl)-5-(3,4-dimethylphenyl)-1,3,4-oxadiazole (PubChem CID 62856515) has the molecular formula C13H15BrN2O and a molecular weight of 295.18 g/mol. Its IUPAC name is 2-(1-bromopropyl)-5-(3,4-dimethylphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-(1-bromopropyl)-5-(3,4-dimethylphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 62856515 |
| Molecular Formula | C13H15BrN2O |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 2-(1-bromopropyl)-5-(3,4-dimethylphenyl)-1,3,4-oxadiazole |
| SMILES | CCC(Br)c1nnc(-c2ccc(C)c(C)c2)o1 |
| InChI | InChI=1S/C13H15BrN2O/c1-4-11(14)13-16-15-12(17-13)10-6-5-8(2)9(3)7-10/h5-7,11H,4H2,1-3H3 |
| InChIKey | HTLAANNFUFGEPE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|