C12H13BrN2OS — CID 79215563
2-(1-bromopropyl)-5-(4-methylsulfanylphenyl)-1,3,4-oxadiazole (PubChem CID 79215563) has the molecular formula C12H13BrN2OS and a molecular weight of 313.22 g/mol. Its IUPAC name is 2-(1-bromopropyl)-5-(4-methylsulfanylphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-(1-bromopropyl)-5-(4-methylsulfanylphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 79215563 |
| Molecular Formula | C12H13BrN2OS |
| Molecular Weight | 313.22 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | 2-(1-bromopropyl)-5-(4-methylsulfanylphenyl)-1,3,4-oxadiazole |
| SMILES | CCC(Br)c1nnc(-c2ccc(SC)cc2)o1 |
| InChI | InChI=1S/C12H13BrN2OS/c1-3-10(13)12-15-14-11(16-12)8-4-6-9(17-2)7-5-8/h4-7,10H,3H2,1-2H3 |
| InChIKey | CBGJVMTVJOQHFE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.22 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|