C20H18ClN3O — CID 146126635
2-[(7-chloroquinolin-4-yl)amino]-3-(1H-indol-3-yl)propan-1-ol (PubChem CID 146126635) has the molecular formula C20H18ClN3O and a molecular weight of 351.84 g/mol. Its IUPAC name is 2-[(7-chloroquinolin-4-yl)amino]-3-(1H-indol-3-yl)propan-1-ol.
| Compound Name | 2-[(7-chloroquinolin-4-yl)amino]-3-(1H-indol-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 146126635 |
| Molecular Formula | C20H18ClN3O |
| Molecular Weight | 351.84 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 2-[(7-chloroquinolin-4-yl)amino]-3-(1H-indol-3-yl)propan-1-ol |
| SMILES | OCC(Cc1c[nH]c2ccccc12)Nc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C20H18ClN3O/c21-14-5-6-17-19(7-8-22-20(17)10-14)24-15(12-25)9-13-11-23-18-4-2-1-3-16(13)18/h1-8,10-11,15,23,25H,9,12H2,(H,22,24) |
| InChIKey | BGXCLAQBSCAJGK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.84 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |