C20H18Cl2N2O2 — CID 155946346
(E)-3-(3,5-dichlorophenyl)-N-[1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]prop-2-enamide (PubChem CID 155946346) has the molecular formula C20H18Cl2N2O2 and a molecular weight of 389.28 g/mol. Its IUPAC name is (E)-3-(3,5-dichlorophenyl)-N-[1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(3,5-dichlorophenyl)-N-[1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 155946346 |
| Molecular Formula | C20H18Cl2N2O2 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | (E)-3-(3,5-dichlorophenyl)-N-[1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(Cl)cc(Cl)c1)NC(CO)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H18Cl2N2O2/c21-15-7-13(8-16(22)10-15)5-6-20(26)24-17(12-25)9-14-11-23-19-4-2-1-3-18(14)19/h1-8,10-11,17,23,25H,9,12H2,(H,24,26)/b6-5+ |
| InChIKey | IRFOZJFZGCZEOU-AATRIKPKSA-N |
| XLogP | 4.21 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|