C16H20FN3O3S — CID 146126952
N-[1-(3-cyano-4-fluorobenzoyl)piperidin-4-yl]-N-methylethanesulfonamide (PubChem CID 146126952) has the molecular formula C16H20FN3O3S and a molecular weight of 353.42 g/mol. Its IUPAC name is N-[1-(3-cyano-4-fluorobenzoyl)piperidin-4-yl]-N-methylethanesulfonamide.
| Compound Name | N-[1-(3-cyano-4-fluorobenzoyl)piperidin-4-yl]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 146126952 |
| Molecular Formula | C16H20FN3O3S |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-[1-(3-cyano-4-fluorobenzoyl)piperidin-4-yl]-N-methylethanesulfonamide |
| SMILES | CCS(=O)(=O)N(C)C1CCN(C(=O)c2ccc(F)c(C#N)c2)CC1 |
| InChI | InChI=1S/C16H20FN3O3S/c1-3-24(22,23)19(2)14-6-8-20(9-7-14)16(21)12-4-5-15(17)13(10-12)11-18/h4-5,10,14H,3,6-9H2,1-2H3 |
| InChIKey | MCOMFXKVIKNBLE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 81.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |