C12H18N4O — CID 146127944
1-ethyl-1-(2-methylprop-2-enyl)-3-(3-methylpyridazin-4-yl)urea (PubChem CID 146127944) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-ethyl-1-(2-methylprop-2-enyl)-3-(3-methylpyridazin-4-yl)urea.
| Compound Name | 1-ethyl-1-(2-methylprop-2-enyl)-3-(3-methylpyridazin-4-yl)urea |
|---|---|
| PubChem CID | 146127944 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 1-ethyl-1-(2-methylprop-2-enyl)-3-(3-methylpyridazin-4-yl)urea |
| SMILES | C=C(C)CN(CC)C(=O)Nc1ccnnc1C |
| InChI | InChI=1S/C12H18N4O/c1-5-16(8-9(2)3)12(17)14-11-6-7-13-15-10(11)4/h6-7H,2,5,8H2,1,3-4H3,(H,13,14,17) |
| InChIKey | PSGWBJAMDYWDSH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|