C13H15N3O4S2 — CID 146128626
2-ethyl-5-[(4-methylthiadiazol-5-yl)methylsulfamoyl]benzoic acid (PubChem CID 146128626) has the molecular formula C13H15N3O4S2 and a molecular weight of 341.41 g/mol. Its IUPAC name is 2-ethyl-5-[(4-methylthiadiazol-5-yl)methylsulfamoyl]benzoic acid.
| Compound Name | 2-ethyl-5-[(4-methylthiadiazol-5-yl)methylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 146128626 |
| Molecular Formula | C13H15N3O4S2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 2-ethyl-5-[(4-methylthiadiazol-5-yl)methylsulfamoyl]benzoic acid |
| SMILES | CCc1ccc(S(=O)(=O)NCc2snnc2C)cc1C(=O)O |
| InChI | InChI=1S/C13H15N3O4S2/c1-3-9-4-5-10(6-11(9)13(17)18)22(19,20)14-7-12-8(2)15-16-21-12/h4-6,14H,3,7H2,1-2H3,(H,17,18) |
| InChIKey | IHKHOYKXOBTDEO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |