C15H13ClN4S — CID 146128776
4-[[1-(3-chlorophenyl)imidazol-2-yl]sulfanylmethyl]pyridin-2-amine (PubChem CID 146128776) has the molecular formula C15H13ClN4S and a molecular weight of 316.82 g/mol. Its IUPAC name is 4-[[1-(3-chlorophenyl)imidazol-2-yl]sulfanylmethyl]pyridin-2-amine.
| Compound Name | 4-[[1-(3-chlorophenyl)imidazol-2-yl]sulfanylmethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 146128776 |
| Molecular Formula | C15H13ClN4S |
| Molecular Weight | 316.82 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 4-[[1-(3-chlorophenyl)imidazol-2-yl]sulfanylmethyl]pyridin-2-amine |
| SMILES | Nc1cc(CSc2nccn2-c2cccc(Cl)c2)ccn1 |
| InChI | InChI=1S/C15H13ClN4S/c16-12-2-1-3-13(9-12)20-7-6-19-15(20)21-10-11-4-5-18-14(17)8-11/h1-9H,10H2,(H2,17,18) |
| InChIKey | WSSIHZFSCYSLGR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.82 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |