C17H20FN5O3S — CID 146129639
N-(2-fluoro-5-methylsulfonylphenyl)-2-(4-pyridazin-3-ylpiperazin-1-yl)acetamide (PubChem CID 146129639) has the molecular formula C17H20FN5O3S and a molecular weight of 393.44 g/mol. Its IUPAC name is N-(2-fluoro-5-methylsulfonylphenyl)-2-(4-pyridazin-3-ylpiperazin-1-yl)acetamide.
| Compound Name | N-(2-fluoro-5-methylsulfonylphenyl)-2-(4-pyridazin-3-ylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 146129639 |
| Molecular Formula | C17H20FN5O3S |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | N-(2-fluoro-5-methylsulfonylphenyl)-2-(4-pyridazin-3-ylpiperazin-1-yl)acetamide |
| SMILES | CS(=O)(=O)c1ccc(F)c(NC(=O)CN2CCN(c3cccnn3)CC2)c1 |
| InChI | InChI=1S/C17H20FN5O3S/c1-27(25,26)13-4-5-14(18)15(11-13)20-17(24)12-22-7-9-23(10-8-22)16-3-2-6-19-21-16/h2-6,11H,7-10,12H2,1H3,(H,20,24) |
| InChIKey | QPVWKDGLNYBWRT-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |