C15H20FNO5S — CID 146130959
2-[5-(3-fluoro-3-methylpiperidin-1-yl)sulfonyl-2-methoxyphenyl]acetic acid (PubChem CID 146130959) has the molecular formula C15H20FNO5S and a molecular weight of 345.39 g/mol. Its IUPAC name is 2-[5-(3-fluoro-3-methylpiperidin-1-yl)sulfonyl-2-methoxyphenyl]acetic acid.
| Compound Name | 2-[5-(3-fluoro-3-methylpiperidin-1-yl)sulfonyl-2-methoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 146130959 |
| Molecular Formula | C15H20FNO5S |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 2-[5-(3-fluoro-3-methylpiperidin-1-yl)sulfonyl-2-methoxyphenyl]acetic acid |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC(C)(F)C2)cc1CC(=O)O |
| InChI | InChI=1S/C15H20FNO5S/c1-15(16)6-3-7-17(10-15)23(20,21)12-4-5-13(22-2)11(8-12)9-14(18)19/h4-5,8H,3,6-7,9-10H2,1-2H3,(H,18,19) |
| InChIKey | DCQRERXBZBSZJJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |