C23H29NO6S — CID 45214940
ethyl 3-benzyl-1-(3,4-dimethoxyphenyl)sulfonylpiperidine-3-carboxylate (PubChem CID 45214940) has the molecular formula C23H29NO6S and a molecular weight of 447.55 g/mol. Its IUPAC name is ethyl 3-benzyl-1-(3,4-dimethoxyphenyl)sulfonylpiperidine-3-carboxylate.
| Compound Name | ethyl 3-benzyl-1-(3,4-dimethoxyphenyl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 45214940 |
| Molecular Formula | C23H29NO6S |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | ethyl 3-benzyl-1-(3,4-dimethoxyphenyl)sulfonylpiperidine-3-carboxylate |
| SMILES | CCOC(=O)C1(Cc2ccccc2)CCCN(S(=O)(=O)c2ccc(OC)c(OC)c2)C1 |
| InChI | InChI=1S/C23H29NO6S/c1-4-30-22(25)23(16-18-9-6-5-7-10-18)13-8-14-24(17-23)31(26,27)19-11-12-20(28-2)21(15-19)29-3/h5-7,9-12,15H,4,8,13-14,16-17H2,1-3H3 |
| InChIKey | AONYOLXNGZFVRS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |