C24H29NO5S — CID 26396397
ethyl (3R)-1-(4-acetylphenyl)sulfonyl-3-[(2-methylphenyl)methyl]piperidine-3-carboxylate (PubChem CID 26396397) has the molecular formula C24H29NO5S and a molecular weight of 443.57 g/mol. Its IUPAC name is ethyl (3R)-1-(4-acetylphenyl)sulfonyl-3-[(2-methylphenyl)methyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-(4-acetylphenyl)sulfonyl-3-[(2-methylphenyl)methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 26396397 |
| Molecular Formula | C24H29NO5S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | ethyl (3R)-1-(4-acetylphenyl)sulfonyl-3-[(2-methylphenyl)methyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1(Cc2ccccc2C)CCCN(S(=O)(=O)c2ccc(C(C)=O)cc2)C1 |
| InChI | InChI=1S/C24H29NO5S/c1-4-30-23(27)24(16-21-9-6-5-8-18(21)2)14-7-15-25(17-24)31(28,29)22-12-10-20(11-13-22)19(3)26/h5-6,8-13H,4,7,14-17H2,1-3H3/t24-/m1/s1 |
| InChIKey | PHHNHTVYNNNZAQ-XMMPIXPASA-N |
| XLogP | 3.77 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |