C22H26N2O3 — CID 26331861
ethyl (3S)-3-[(2-methylphenyl)methyl]-1-(pyridine-3-carbonyl)piperidine-3-carboxylate (PubChem CID 26331861) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is ethyl (3S)-3-[(2-methylphenyl)methyl]-1-(pyridine-3-carbonyl)piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-3-[(2-methylphenyl)methyl]-1-(pyridine-3-carbonyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 26331861 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | ethyl (3S)-3-[(2-methylphenyl)methyl]-1-(pyridine-3-carbonyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@]1(Cc2ccccc2C)CCCN(C(=O)c2cccnc2)C1 |
| InChI | InChI=1S/C22H26N2O3/c1-3-27-21(26)22(14-18-9-5-4-8-17(18)2)11-7-13-24(16-22)20(25)19-10-6-12-23-15-19/h4-6,8-10,12,15H,3,7,11,13-14,16H2,1-2H3/t22-/m0/s1 |
| InChIKey | UHLLCXKRJYENOS-QFIPXVFZSA-N |
| XLogP | 3.42 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |