C19H23NO4S2 — CID 45232505
ethyl 3-benzyl-1-thiophen-3-ylsulfonylpiperidine-3-carboxylate (PubChem CID 45232505) has the molecular formula C19H23NO4S2 and a molecular weight of 393.53 g/mol. Its IUPAC name is ethyl 3-benzyl-1-thiophen-3-ylsulfonylpiperidine-3-carboxylate.
| Compound Name | ethyl 3-benzyl-1-thiophen-3-ylsulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 45232505 |
| Molecular Formula | C19H23NO4S2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | ethyl 3-benzyl-1-thiophen-3-ylsulfonylpiperidine-3-carboxylate |
| SMILES | CCOC(=O)C1(Cc2ccccc2)CCCN(S(=O)(=O)c2ccsc2)C1 |
| InChI | InChI=1S/C19H23NO4S2/c1-2-24-18(21)19(13-16-7-4-3-5-8-16)10-6-11-20(15-19)26(22,23)17-9-12-25-14-17/h3-5,7-9,12,14H,2,6,10-11,13,15H2,1H3 |
| InChIKey | MZWQTQSMAODEDW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |