C15H17F3N2O3 — CID 146133070
N-[2-methoxy-4-(trifluoromethyl)phenyl]-1-methyl-6-oxopiperidine-2-carboxamide (PubChem CID 146133070) has the molecular formula C15H17F3N2O3 and a molecular weight of 330.31 g/mol. Its IUPAC name is N-[2-methoxy-4-(trifluoromethyl)phenyl]-1-methyl-6-oxopiperidine-2-carboxamide.
| Compound Name | N-[2-methoxy-4-(trifluoromethyl)phenyl]-1-methyl-6-oxopiperidine-2-carboxamide |
|---|---|
| PubChem CID | 146133070 |
| Molecular Formula | C15H17F3N2O3 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | N-[2-methoxy-4-(trifluoromethyl)phenyl]-1-methyl-6-oxopiperidine-2-carboxamide |
| SMILES | COc1cc(C(F)(F)F)ccc1NC(=O)C1CCCC(=O)N1C |
| InChI | InChI=1S/C15H17F3N2O3/c1-20-11(4-3-5-13(20)21)14(22)19-10-7-6-9(15(16,17)18)8-12(10)23-2/h6-8,11H,3-5H2,1-2H3,(H,19,22) |
| InChIKey | WRLVSNMAPIBVEC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |