C16H28N4OS — CID 146133848
1-[(1-aminocyclohexyl)methyl]-3-[2-(dimethylamino)-2-thiophen-2-ylethyl]urea (PubChem CID 146133848) has the molecular formula C16H28N4OS and a molecular weight of 324.49 g/mol. Its IUPAC name is 1-[(1-aminocyclohexyl)methyl]-3-[2-(dimethylamino)-2-thiophen-2-ylethyl]urea.
| Compound Name | 1-[(1-aminocyclohexyl)methyl]-3-[2-(dimethylamino)-2-thiophen-2-ylethyl]urea |
|---|---|
| PubChem CID | 146133848 |
| Molecular Formula | C16H28N4OS |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 1-[(1-aminocyclohexyl)methyl]-3-[2-(dimethylamino)-2-thiophen-2-ylethyl]urea |
| SMILES | CN(C)C(CNC(=O)NCC1(N)CCCCC1)c1cccs1 |
| InChI | InChI=1S/C16H28N4OS/c1-20(2)13(14-7-6-10-22-14)11-18-15(21)19-12-16(17)8-4-3-5-9-16/h6-7,10,13H,3-5,8-9,11-12,17H2,1-2H3,(H2,18,19,21) |
| InChIKey | YUDLBBVMEFTMTJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |