C15H25N3OS — CID 81172882
2-[1-(aminomethyl)cyclobutyl]-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]acetamide (PubChem CID 81172882) has the molecular formula C15H25N3OS and a molecular weight of 295.45 g/mol. Its IUPAC name is 2-[1-(aminomethyl)cyclobutyl]-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]acetamide.
| Compound Name | 2-[1-(aminomethyl)cyclobutyl]-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]acetamide |
|---|---|
| PubChem CID | 81172882 |
| Molecular Formula | C15H25N3OS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 2-[1-(aminomethyl)cyclobutyl]-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]acetamide |
| SMILES | CN(C)C(CNC(=O)CC1(CN)CCC1)c1cccs1 |
| InChI | InChI=1S/C15H25N3OS/c1-18(2)12(13-5-3-8-20-13)10-17-14(19)9-15(11-16)6-4-7-15/h3,5,8,12H,4,6-7,9-11,16H2,1-2H3,(H,17,19) |
| InChIKey | JFYNVRBICDSGSL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |