C20H21FN2O4 — CID 146134800
4-[[6-(4-fluorophenoxy)-2-pyridinyl]methylcarbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 146134800) has the molecular formula C20H21FN2O4 and a molecular weight of 372.40 g/mol. Its IUPAC name is 4-[[6-(4-fluorophenoxy)-2-pyridinyl]methylcarbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[6-(4-fluorophenoxy)-2-pyridinyl]methylcarbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 146134800 |
| Molecular Formula | C20H21FN2O4 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 4-[[6-(4-fluorophenoxy)-2-pyridinyl]methylcarbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)NCc2cccc(Oc3ccc(F)cc3)n2)CC1 |
| InChI | InChI=1S/C20H21FN2O4/c21-15-8-10-17(11-9-15)27-18-3-1-2-16(23-18)12-22-19(24)13-4-6-14(7-5-13)20(25)26/h1-3,8-11,13-14H,4-7,12H2,(H,22,24)(H,25,26) |
| InChIKey | FTMGHOPHERIICK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |