C15H19NO5S — CID 146135367
4-[[3,6-dihydro-2H-pyran-5-ylmethyl(methyl)sulfamoyl]methyl]benzoic acid (PubChem CID 146135367) has the molecular formula C15H19NO5S and a molecular weight of 325.39 g/mol. Its IUPAC name is 4-[[3,6-dihydro-2H-pyran-5-ylmethyl(methyl)sulfamoyl]methyl]benzoic acid.
| Compound Name | 4-[[3,6-dihydro-2H-pyran-5-ylmethyl(methyl)sulfamoyl]methyl]benzoic acid |
|---|---|
| PubChem CID | 146135367 |
| Molecular Formula | C15H19NO5S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 4-[[3,6-dihydro-2H-pyran-5-ylmethyl(methyl)sulfamoyl]methyl]benzoic acid |
| SMILES | CN(CC1=CCCOC1)S(=O)(=O)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C15H19NO5S/c1-16(9-13-3-2-8-21-10-13)22(19,20)11-12-4-6-14(7-5-12)15(17)18/h3-7H,2,8-11H2,1H3,(H,17,18) |
| InChIKey | WUGZJACYJPLSBI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|