C15H16F3NO5S — CID 146136335
1-[[3-methylsulfonyl-5-(trifluoromethyl)phenyl]methylcarbamoyl]cyclobutane-1-carboxylic acid (PubChem CID 146136335) has the molecular formula C15H16F3NO5S and a molecular weight of 379.36 g/mol. Its IUPAC name is 1-[[3-methylsulfonyl-5-(trifluoromethyl)phenyl]methylcarbamoyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[[3-methylsulfonyl-5-(trifluoromethyl)phenyl]methylcarbamoyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 146136335 |
| Molecular Formula | C15H16F3NO5S |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 1-[[3-methylsulfonyl-5-(trifluoromethyl)phenyl]methylcarbamoyl]cyclobutane-1-carboxylic acid |
| SMILES | CS(=O)(=O)c1cc(CNC(=O)C2(C(=O)O)CCC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H16F3NO5S/c1-25(23,24)11-6-9(5-10(7-11)15(16,17)18)8-19-12(20)14(13(21)22)3-2-4-14/h5-7H,2-4,8H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | FFFVNJMMCRRLKG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|