C17H17F2N3O — CID 146139892
6-(difluoromethyl)-N-[3-(2-methylphenyl)cyclobutyl]pyrimidine-4-carboxamide (PubChem CID 146139892) has the molecular formula C17H17F2N3O and a molecular weight of 317.34 g/mol. Its IUPAC name is 6-(difluoromethyl)-N-[3-(2-methylphenyl)cyclobutyl]pyrimidine-4-carboxamide.
| Compound Name | 6-(difluoromethyl)-N-[3-(2-methylphenyl)cyclobutyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 146139892 |
| Molecular Formula | C17H17F2N3O |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 6-(difluoromethyl)-N-[3-(2-methylphenyl)cyclobutyl]pyrimidine-4-carboxamide |
| SMILES | Cc1ccccc1C1CC(NC(=O)c2cc(C(F)F)ncn2)C1 |
| InChI | InChI=1S/C17H17F2N3O/c1-10-4-2-3-5-13(10)11-6-12(7-11)22-17(23)15-8-14(16(18)19)20-9-21-15/h2-5,8-9,11-12,16H,6-7H2,1H3,(H,22,23) |
| InChIKey | QWJXZNHLAKABMY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |