C22H25FN2O — CID 146140219
[4-(cyclobutylamino)piperidin-1-yl]-(2-fluoro-4-phenylphenyl)methanone (PubChem CID 146140219) has the molecular formula C22H25FN2O and a molecular weight of 352.45 g/mol. Its IUPAC name is [4-(cyclobutylamino)piperidin-1-yl]-(2-fluoro-4-phenylphenyl)methanone.
| Compound Name | [4-(cyclobutylamino)piperidin-1-yl]-(2-fluoro-4-phenylphenyl)methanone |
|---|---|
| PubChem CID | 146140219 |
| Molecular Formula | C22H25FN2O |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | [4-(cyclobutylamino)piperidin-1-yl]-(2-fluoro-4-phenylphenyl)methanone |
| SMILES | O=C(c1ccc(-c2ccccc2)cc1F)N1CCC(NC2CCC2)CC1 |
| InChI | InChI=1S/C22H25FN2O/c23-21-15-17(16-5-2-1-3-6-16)9-10-20(21)22(26)25-13-11-19(12-14-25)24-18-7-4-8-18/h1-3,5-6,9-10,15,18-19,24H,4,7-8,11-14H2 |
| InChIKey | BPFDMRIBQGYWAK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |