C11H9F3N4O3S — CID 146142602
2-[4-[[4-(trifluoromethyl)thiophen-3-yl]methylcarbamoyl]triazol-1-yl]acetic acid (PubChem CID 146142602) has the molecular formula C11H9F3N4O3S and a molecular weight of 334.28 g/mol. Its IUPAC name is 2-[4-[[4-(trifluoromethyl)thiophen-3-yl]methylcarbamoyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[4-(trifluoromethyl)thiophen-3-yl]methylcarbamoyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 146142602 |
| Molecular Formula | C11H9F3N4O3S |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 2-[4-[[4-(trifluoromethyl)thiophen-3-yl]methylcarbamoyl]triazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(C(=O)NCc2cscc2C(F)(F)F)nn1 |
| InChI | InChI=1S/C11H9F3N4O3S/c12-11(13,14)7-5-22-4-6(7)1-15-10(21)8-2-18(17-16-8)3-9(19)20/h2,4-5H,1,3H2,(H,15,21)(H,19,20) |
| InChIKey | VEAHWNWUHCYBJC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |