C18H19N3O2S — CID 146143790
8-(2,3-dihydro-1H-inden-5-ylsulfonyl)-1,4,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene (PubChem CID 146143790) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is 8-(2,3-dihydro-1H-inden-5-ylsulfonyl)-1,4,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene.
| Compound Name | 8-(2,3-dihydro-1H-inden-5-ylsulfonyl)-1,4,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 146143790 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 8-(2,3-dihydro-1H-inden-5-ylsulfonyl)-1,4,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
| SMILES | O=S(=O)(c1ccc2c(c1)CCC2)N1c2ccncc2N2CCC1C2 |
| InChI | InChI=1S/C18H19N3O2S/c22-24(23,16-5-4-13-2-1-3-14(13)10-16)21-15-7-9-20(12-15)18-11-19-8-6-17(18)21/h4-6,8,10-11,15H,1-3,7,9,12H2 |
| InChIKey | DGFMSRILVGJXCK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |