C15H18FN5S — CID 146144879
N-[2-(5-fluoro-1-methylbenzimidazol-2-yl)ethyl]-1-(4-methylthiadiazol-5-yl)ethanamine (PubChem CID 146144879) has the molecular formula C15H18FN5S and a molecular weight of 319.41 g/mol. Its IUPAC name is N-[2-(5-fluoro-1-methylbenzimidazol-2-yl)ethyl]-1-(4-methylthiadiazol-5-yl)ethanamine.
| Compound Name | N-[2-(5-fluoro-1-methylbenzimidazol-2-yl)ethyl]-1-(4-methylthiadiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 146144879 |
| Molecular Formula | C15H18FN5S |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | N-[2-(5-fluoro-1-methylbenzimidazol-2-yl)ethyl]-1-(4-methylthiadiazol-5-yl)ethanamine |
| SMILES | Cc1nnsc1C(C)NCCc1nc2cc(F)ccc2n1C |
| InChI | InChI=1S/C15H18FN5S/c1-9(15-10(2)19-20-22-15)17-7-6-14-18-12-8-11(16)4-5-13(12)21(14)3/h4-5,8-9,17H,6-7H2,1-3H3 |
| InChIKey | YOGSWEFHGPGVNZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |