C15H19FN2Si — CID 66598338
4-(5-fluoro-1-methylbenzimidazol-2-yl)but-1-ynyl-trimethylsilane (PubChem CID 66598338) has the molecular formula C15H19FN2Si and a molecular weight of 274.41 g/mol. Its IUPAC name is 4-(5-fluoro-1-methylbenzimidazol-2-yl)but-1-ynyl-trimethylsilane.
| Compound Name | 4-(5-fluoro-1-methylbenzimidazol-2-yl)but-1-ynyl-trimethylsilane |
|---|---|
| PubChem CID | 66598338 |
| Molecular Formula | C15H19FN2Si |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 4-(5-fluoro-1-methylbenzimidazol-2-yl)but-1-ynyl-trimethylsilane |
| SMILES | Cn1c(CCC#C[Si](C)(C)C)nc2cc(F)ccc21 |
| InChI | InChI=1S/C15H19FN2Si/c1-18-14-9-8-12(16)11-13(14)17-15(18)7-5-6-10-19(2,3)4/h8-9,11H,5,7H2,1-4H3 |
| InChIKey | ANQCQJJIAZCVNI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|