C17H22N2OS — CID 146146044
N-(2-methyl-2-phenylpropyl)-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]formamide (PubChem CID 146146044) has the molecular formula C17H22N2OS and a molecular weight of 302.44 g/mol. Its IUPAC name is N-(2-methyl-2-phenylpropyl)-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]formamide.
| Compound Name | N-(2-methyl-2-phenylpropyl)-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]formamide |
|---|---|
| PubChem CID | 146146044 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | N-(2-methyl-2-phenylpropyl)-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]formamide |
| SMILES | Cc1nc(CCN(C=O)CC(C)(C)c2ccccc2)cs1 |
| InChI | InChI=1S/C17H22N2OS/c1-14-18-16(11-21-14)9-10-19(13-20)12-17(2,3)15-7-5-4-6-8-15/h4-8,11,13H,9-10,12H2,1-3H3 |
| InChIKey | SFAZXLYFBSKEPT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|