C18H25N3O2 — CID 146146108
N-(1-hydroxy-4,4-dimethylpentan-2-yl)-N-[(3-pyrazol-1-ylphenyl)methyl]formamide (PubChem CID 146146108) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is N-(1-hydroxy-4,4-dimethylpentan-2-yl)-N-[(3-pyrazol-1-ylphenyl)methyl]formamide.
| Compound Name | N-(1-hydroxy-4,4-dimethylpentan-2-yl)-N-[(3-pyrazol-1-ylphenyl)methyl]formamide |
|---|---|
| PubChem CID | 146146108 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | N-(1-hydroxy-4,4-dimethylpentan-2-yl)-N-[(3-pyrazol-1-ylphenyl)methyl]formamide |
| SMILES | CC(C)(C)CC(CO)N(C=O)Cc1cccc(-n2cccn2)c1 |
| InChI | InChI=1S/C18H25N3O2/c1-18(2,3)11-17(13-22)20(14-23)12-15-6-4-7-16(10-15)21-9-5-8-19-21/h4-10,14,17,22H,11-13H2,1-3H3 |
| InChIKey | QPTGTJJJIHMMHJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|