C22H27N3O5 — CID 146147610
1-(3-methoxy-1-morpholin-4-yl-1-oxopropan-2-yl)-3-(2-methyl-4-phenoxyphenyl)urea (PubChem CID 146147610) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is 1-(3-methoxy-1-morpholin-4-yl-1-oxopropan-2-yl)-3-(2-methyl-4-phenoxyphenyl)urea.
| Compound Name | 1-(3-methoxy-1-morpholin-4-yl-1-oxopropan-2-yl)-3-(2-methyl-4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 146147610 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 1-(3-methoxy-1-morpholin-4-yl-1-oxopropan-2-yl)-3-(2-methyl-4-phenoxyphenyl)urea |
| SMILES | COCC(NC(=O)Nc1ccc(Oc2ccccc2)cc1C)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C22H27N3O5/c1-16-14-18(30-17-6-4-3-5-7-17)8-9-19(16)23-22(27)24-20(15-28-2)21(26)25-10-12-29-13-11-25/h3-9,14,20H,10-13,15H2,1-2H3,(H2,23,24,27) |
| InChIKey | DXKARFPNQJLWMD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |