C19H21N5 — CID 146148338
5-[3-[(6-pyridin-2-yl-3-pyridinyl)methylamino]propyl]pyridin-2-amine (PubChem CID 146148338) has the molecular formula C19H21N5 and a molecular weight of 319.41 g/mol. Its IUPAC name is 5-[3-[(6-pyridin-2-yl-3-pyridinyl)methylamino]propyl]pyridin-2-amine.
| Compound Name | 5-[3-[(6-pyridin-2-yl-3-pyridinyl)methylamino]propyl]pyridin-2-amine |
|---|---|
| PubChem CID | 146148338 |
| Molecular Formula | C19H21N5 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 5-[3-[(6-pyridin-2-yl-3-pyridinyl)methylamino]propyl]pyridin-2-amine |
| SMILES | Nc1ccc(CCCNCc2ccc(-c3ccccn3)nc2)cn1 |
| InChI | InChI=1S/C19H21N5/c20-19-9-7-15(13-24-19)4-3-10-21-12-16-6-8-18(23-14-16)17-5-1-2-11-22-17/h1-2,5-9,11,13-14,21H,3-4,10,12H2,(H2,20,24) |
| InChIKey | IZZRVYUDGDZJGH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|