C18H16N6O — CID 146153633
4-(3,5-dimethylpyrazol-1-yl)-N-imidazo[1,2-a]pyrazin-3-ylbenzamide (PubChem CID 146153633) has the molecular formula C18H16N6O and a molecular weight of 332.37 g/mol. Its IUPAC name is 4-(3,5-dimethylpyrazol-1-yl)-N-imidazo[1,2-a]pyrazin-3-ylbenzamide.
| Compound Name | 4-(3,5-dimethylpyrazol-1-yl)-N-imidazo[1,2-a]pyrazin-3-ylbenzamide |
|---|---|
| PubChem CID | 146153633 |
| Molecular Formula | C18H16N6O |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 4-(3,5-dimethylpyrazol-1-yl)-N-imidazo[1,2-a]pyrazin-3-ylbenzamide |
| SMILES | Cc1cc(C)n(-c2ccc(C(=O)Nc3cnc4cnccn34)cc2)n1 |
| InChI | InChI=1S/C18H16N6O/c1-12-9-13(2)24(22-12)15-5-3-14(4-6-15)18(25)21-17-11-20-16-10-19-7-8-23(16)17/h3-11H,1-2H3,(H,21,25) |
| InChIKey | ZQDAYTSWHLSENR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |