C14H15ClN4O3S — CID 146154675
5-chloro-N-methylsulfonyl-6-(1-pyridin-3-ylethylamino)pyridine-3-carboxamide (PubChem CID 146154675) has the molecular formula C14H15ClN4O3S and a molecular weight of 354.82 g/mol. Its IUPAC name is 5-chloro-N-methylsulfonyl-6-(1-pyridin-3-ylethylamino)pyridine-3-carboxamide.
| Compound Name | 5-chloro-N-methylsulfonyl-6-(1-pyridin-3-ylethylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 146154675 |
| Molecular Formula | C14H15ClN4O3S |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 5-chloro-N-methylsulfonyl-6-(1-pyridin-3-ylethylamino)pyridine-3-carboxamide |
| SMILES | CC(Nc1ncc(C(=O)NS(C)(=O)=O)cc1Cl)c1cccnc1 |
| InChI | InChI=1S/C14H15ClN4O3S/c1-9(10-4-3-5-16-7-10)18-13-12(15)6-11(8-17-13)14(20)19-23(2,21)22/h3-9H,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | VPHXPXUGPCWQET-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |