C14H13FN2O3S — CID 146154707
2-cyclopropyl-6-fluoro-N-methylsulfonylquinoline-4-carboxamide (PubChem CID 146154707) has the molecular formula C14H13FN2O3S and a molecular weight of 308.33 g/mol. Its IUPAC name is 2-cyclopropyl-6-fluoro-N-methylsulfonylquinoline-4-carboxamide.
| Compound Name | 2-cyclopropyl-6-fluoro-N-methylsulfonylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 146154707 |
| Molecular Formula | C14H13FN2O3S |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 2-cyclopropyl-6-fluoro-N-methylsulfonylquinoline-4-carboxamide |
| SMILES | CS(=O)(=O)NC(=O)c1cc(C2CC2)nc2ccc(F)cc12 |
| InChI | InChI=1S/C14H13FN2O3S/c1-21(19,20)17-14(18)11-7-13(8-2-3-8)16-12-5-4-9(15)6-10(11)12/h4-8H,2-3H2,1H3,(H,17,18) |
| InChIKey | KCIYCEFYXLZIER-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |