C18H19FN2O3S — CID 127367740
2-cyclopropyl-N-(1,1-dioxothian-3-yl)-6-fluoroquinoline-4-carboxamide (PubChem CID 127367740) has the molecular formula C18H19FN2O3S and a molecular weight of 362.43 g/mol. Its IUPAC name is 2-cyclopropyl-N-(1,1-dioxothian-3-yl)-6-fluoroquinoline-4-carboxamide.
| Compound Name | 2-cyclopropyl-N-(1,1-dioxothian-3-yl)-6-fluoroquinoline-4-carboxamide |
|---|---|
| PubChem CID | 127367740 |
| Molecular Formula | C18H19FN2O3S |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 2-cyclopropyl-N-(1,1-dioxothian-3-yl)-6-fluoroquinoline-4-carboxamide |
| SMILES | O=C(NC1CCCS(=O)(=O)C1)c1cc(C2CC2)nc2ccc(F)cc12 |
| InChI | InChI=1S/C18H19FN2O3S/c19-12-5-6-16-14(8-12)15(9-17(21-16)11-3-4-11)18(22)20-13-2-1-7-25(23,24)10-13/h5-6,8-9,11,13H,1-4,7,10H2,(H,20,22) |
| InChIKey | JVZSVLKHRIEAOY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |