C8H17N2O2S+ — CID 146155158
[(Z)-3-(dimethylamino)-2-methylsulfonylprop-2-enylidene]-dimethylazanium (PubChem CID 146155158) has the molecular formula C8H17N2O2S+ and a molecular weight of 205.30 g/mol. Its IUPAC name is [(Z)-3-(dimethylamino)-2-methylsulfonylprop-2-enylidene]-dimethylazanium.
| Compound Name | [(Z)-3-(dimethylamino)-2-methylsulfonylprop-2-enylidene]-dimethylazanium |
|---|---|
| PubChem CID | 146155158 |
| Molecular Formula | C8H17N2O2S+ |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | [(Z)-3-(dimethylamino)-2-methylsulfonylprop-2-enylidene]-dimethylazanium |
| SMILES | CN(C)/C=C(/C=[N+](C)C)S(C)(=O)=O |
| InChI | InChI=1S/C8H17N2O2S/c1-9(2)6-8(7-10(3)4)13(5,11)12/h6-7H,1-5H3/q+1 |
| InChIKey | TTYOGKXAVFAFSA-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 40.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|