C8H15F2N2O2S+ — CID 167720960
[(Z)-2-(difluoromethylsulfonyl)-3-(dimethylamino)prop-2-enylidene]-dimethylazanium (PubChem CID 167720960) has the molecular formula C8H15F2N2O2S+ and a molecular weight of 241.28 g/mol. Its IUPAC name is [(Z)-2-(difluoromethylsulfonyl)-3-(dimethylamino)prop-2-enylidene]-dimethylazanium.
| Compound Name | [(Z)-2-(difluoromethylsulfonyl)-3-(dimethylamino)prop-2-enylidene]-dimethylazanium |
|---|---|
| PubChem CID | 167720960 |
| Molecular Formula | C8H15F2N2O2S+ |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | [(Z)-2-(difluoromethylsulfonyl)-3-(dimethylamino)prop-2-enylidene]-dimethylazanium |
| SMILES | CN(C)/C=C(/C=[N+](C)C)S(=O)(=O)C(F)F |
| InChI | InChI=1S/C8H15F2N2O2S/c1-11(2)5-7(6-12(3)4)15(13,14)8(9)10/h5-6,8H,1-4H3/q+1 |
| InChIKey | UNMZIHMTVDIRAK-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 40.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|