C12H20BF3KNO2 — CID 146155743
potassium trifluoro-[6-[(2-methylpropan-2-yl)oxycarbonyl]-6-azaspiro[2.5]octan-2-yl]boranuide (PubChem CID 146155743) has the molecular formula C12H20BF3KNO2 and a molecular weight of 317.20 g/mol. Its IUPAC name is potassium trifluoro-[6-[(2-methylpropan-2-yl)oxycarbonyl]-6-azaspiro[2.5]octan-2-yl]boranuide.
| Compound Name | potassium trifluoro-[6-[(2-methylpropan-2-yl)oxycarbonyl]-6-azaspiro[2.5]octan-2-yl]boranuide |
|---|---|
| PubChem CID | 146155743 |
| Molecular Formula | C12H20BF3KNO2 |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | potassium trifluoro-[6-[(2-methylpropan-2-yl)oxycarbonyl]-6-azaspiro[2.5]octan-2-yl]boranuide |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC2[B-](F)(F)F.[K+] |
| InChI | InChI=1S/C12H20BF3NO2.K/c1-11(2,3)19-10(18)17-6-4-12(5-7-17)8-9(12)13(14,15)16;/h9H,4-8H2,1-3H3;/q-1;+1 |
| InChIKey | BYIPAVCOMXWXSM-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|