C16H29NO2 — CID 150980287
tert-butyl 2-butyl-6-azaspiro[2.5]octane-6-carboxylate (PubChem CID 150980287) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is tert-butyl 2-butyl-6-azaspiro[2.5]octane-6-carboxylate.
| Compound Name | tert-butyl 2-butyl-6-azaspiro[2.5]octane-6-carboxylate |
|---|---|
| PubChem CID | 150980287 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | tert-butyl 2-butyl-6-azaspiro[2.5]octane-6-carboxylate |
| SMILES | CCCCC1CC12CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C16H29NO2/c1-5-6-7-13-12-16(13)8-10-17(11-9-16)14(18)19-15(2,3)4/h13H,5-12H2,1-4H3 |
| InChIKey | LPYKFHRYEXCNFR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |