C23H34ClN3O4 — CID 142325154
tert-butyl 2-[3-[[6-chloro-5-(dimethylcarbamoyl)-2-pyridinyl]oxy]propyl]-6-azaspiro[2.5]octane-6-carboxylate (PubChem CID 142325154) has the molecular formula C23H34ClN3O4 and a molecular weight of 452.00 g/mol. Its IUPAC name is tert-butyl 2-[3-[[6-chloro-5-(dimethylcarbamoyl)-2-pyridinyl]oxy]propyl]-6-azaspiro[2.5]octane-6-carboxylate.
| Compound Name | tert-butyl 2-[3-[[6-chloro-5-(dimethylcarbamoyl)-2-pyridinyl]oxy]propyl]-6-azaspiro[2.5]octane-6-carboxylate |
|---|---|
| PubChem CID | 142325154 |
| Molecular Formula | C23H34ClN3O4 |
| Molecular Weight | 452.00 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | tert-butyl 2-[3-[[6-chloro-5-(dimethylcarbamoyl)-2-pyridinyl]oxy]propyl]-6-azaspiro[2.5]octane-6-carboxylate |
| SMILES | CN(C)C(=O)c1ccc(OCCCC2CC23CCN(C(=O)OC(C)(C)C)CC3)nc1Cl |
| InChI | InChI=1S/C23H34ClN3O4/c1-22(2,3)31-21(29)27-12-10-23(11-13-27)15-16(23)7-6-14-30-18-9-8-17(19(24)25-18)20(28)26(4)5/h8-9,16H,6-7,10-15H2,1-5H3 |
| InChIKey | NOCKATUPPYVREA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.00 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|