C24H30ClN3O4 — CID 134427171
2-chloro-6-[3-[1-(2-hydroxy-2-phenylacetyl)piperidin-4-yl]propoxy]-N,N-dimethylpyridine-3-carboxamide (PubChem CID 134427171) has the molecular formula C24H30ClN3O4 and a molecular weight of 459.97 g/mol. Its IUPAC name is 2-chloro-6-[3-[1-(2-hydroxy-2-phenylacetyl)piperidin-4-yl]propoxy]-N,N-dimethylpyridine-3-carboxamide.
| Compound Name | 2-chloro-6-[3-[1-(2-hydroxy-2-phenylacetyl)piperidin-4-yl]propoxy]-N,N-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 134427171 |
| Molecular Formula | C24H30ClN3O4 |
| Molecular Weight | 459.97 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 2-chloro-6-[3-[1-(2-hydroxy-2-phenylacetyl)piperidin-4-yl]propoxy]-N,N-dimethylpyridine-3-carboxamide |
| SMILES | CN(C)C(=O)c1ccc(OCCCC2CCN(C(=O)C(O)c3ccccc3)CC2)nc1Cl |
| InChI | InChI=1S/C24H30ClN3O4/c1-27(2)23(30)19-10-11-20(26-22(19)25)32-16-6-7-17-12-14-28(15-13-17)24(31)21(29)18-8-4-3-5-9-18/h3-5,8-11,17,21,29H,6-7,12-16H2,1-2H3 |
| InChIKey | SQGKJBDRWGXFSZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.97 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|