C27H35ClN2O4 — CID 155024329
2-chloro-4-[4-[1-[(2R)-2-hydroxy-2-phenylpropanoyl]piperidin-4-yl]butoxy]-N,N-dimethylbenzamide (PubChem CID 155024329) has the molecular formula C27H35ClN2O4 and a molecular weight of 487.04 g/mol. Its IUPAC name is 2-chloro-4-[4-[1-[(2R)-2-hydroxy-2-phenylpropanoyl]piperidin-4-yl]butoxy]-N,N-dimethylbenzamide.
| Compound Name | 2-chloro-4-[4-[1-[(2R)-2-hydroxy-2-phenylpropanoyl]piperidin-4-yl]butoxy]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 155024329 |
| Molecular Formula | C27H35ClN2O4 |
| Molecular Weight | 487.04 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | 2-chloro-4-[4-[1-[(2R)-2-hydroxy-2-phenylpropanoyl]piperidin-4-yl]butoxy]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(OCCCCC2CCN(C(=O)[C@](C)(O)c3ccccc3)CC2)cc1Cl |
| InChI | InChI=1S/C27H35ClN2O4/c1-27(33,21-10-5-4-6-11-21)26(32)30-16-14-20(15-17-30)9-7-8-18-34-22-12-13-23(24(28)19-22)25(31)29(2)3/h4-6,10-13,19-20,33H,7-9,14-18H2,1-3H3/t27-/m1/s1 |
| InChIKey | QPPKWESNPMVLFK-HHHXNRCGSA-N |
| XLogP | 4.74 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.04 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|