C28H32ClF3N2O4 — CID 155024353
2-chloro-N-cyclopropyl-4-[4-[1-[(2S)-3,3,3-trifluoro-2-hydroxy-2-phenylpropanoyl]piperidin-4-yl]butoxy]benzamide (PubChem CID 155024353) has the molecular formula C28H32ClF3N2O4 and a molecular weight of 553.02 g/mol. Its IUPAC name is 2-chloro-N-cyclopropyl-4-[4-[1-[(2S)-3,3,3-trifluoro-2-hydroxy-2-phenylpropanoyl]piperidin-4-yl]butoxy]benzamide.
| Compound Name | 2-chloro-N-cyclopropyl-4-[4-[1-[(2S)-3,3,3-trifluoro-2-hydroxy-2-phenylpropanoyl]piperidin-4-yl]butoxy]benzamide |
|---|---|
| PubChem CID | 155024353 |
| Molecular Formula | C28H32ClF3N2O4 |
| Molecular Weight | 553.02 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | 2-chloro-N-cyclopropyl-4-[4-[1-[(2S)-3,3,3-trifluoro-2-hydroxy-2-phenylpropanoyl]piperidin-4-yl]butoxy]benzamide |
| SMILES | O=C(NC1CC1)c1ccc(OCCCCC2CCN(C(=O)[C@@](O)(c3ccccc3)C(F)(F)F)CC2)cc1Cl |
| InChI | InChI=1S/C28H32ClF3N2O4/c29-24-18-22(11-12-23(24)25(35)33-21-9-10-21)38-17-5-4-6-19-13-15-34(16-14-19)26(36)27(37,28(30,31)32)20-7-2-1-3-8-20/h1-3,7-8,11-12,18-19,21,37H,4-6,9-10,13-17H2,(H,33,35)/t27-/m0/s1 |
| InChIKey | ZGMREBXXBABQBR-MHZLTWQESA-N |
| XLogP | 5.47 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.02 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|