C28H35ClF3N3O3 — CID 153291091
2-chloro-4-[4-[1-[(2S)-2-(3-ethylphenyl)-3,3,3-trifluoro-2-hydroxypropanoyl]piperidin-4-yl]butylamino]-N-methylbenzamide (PubChem CID 153291091) has the molecular formula C28H35ClF3N3O3 and a molecular weight of 554.05 g/mol. Its IUPAC name is 2-chloro-4-[4-[1-[(2S)-2-(3-ethylphenyl)-3,3,3-trifluoro-2-hydroxypropanoyl]piperidin-4-yl]butylamino]-N-methylbenzamide.
| Compound Name | 2-chloro-4-[4-[1-[(2S)-2-(3-ethylphenyl)-3,3,3-trifluoro-2-hydroxypropanoyl]piperidin-4-yl]butylamino]-N-methylbenzamide |
|---|---|
| PubChem CID | 153291091 |
| Molecular Formula | C28H35ClF3N3O3 |
| Molecular Weight | 554.05 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | 2-chloro-4-[4-[1-[(2S)-2-(3-ethylphenyl)-3,3,3-trifluoro-2-hydroxypropanoyl]piperidin-4-yl]butylamino]-N-methylbenzamide |
| SMILES | CCc1cccc([C@](O)(C(=O)N2CCC(CCCCNc3ccc(C(=O)NC)c(Cl)c3)CC2)C(F)(F)F)c1 |
| InChI | InChI=1S/C28H35ClF3N3O3/c1-3-19-8-6-9-21(17-19)27(38,28(30,31)32)26(37)35-15-12-20(13-16-35)7-4-5-14-34-22-10-11-23(24(29)18-22)25(36)33-2/h6,8-11,17-18,20,34,38H,3-5,7,12-16H2,1-2H3,(H,33,36)/t27-/m0/s1 |
| InChIKey | AUEIYWXVKVSVIC-MHZLTWQESA-N |
| XLogP | 5.53 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.05 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|