C27H33ClF3N3O4 — CID 142321203
2-chloro-N-methyl-4-[4-[1-[(2R)-3,3,3-trifluoro-2-hydroxy-2-(3-methoxyphenyl)propanoyl]piperidin-4-yl]butylamino]benzamide (PubChem CID 142321203) has the molecular formula C27H33ClF3N3O4 and a molecular weight of 556.03 g/mol. Its IUPAC name is 2-chloro-N-methyl-4-[4-[1-[(2R)-3,3,3-trifluoro-2-hydroxy-2-(3-methoxyphenyl)propanoyl]piperidin-4-yl]butylamino]benzamide.
| Compound Name | 2-chloro-N-methyl-4-[4-[1-[(2R)-3,3,3-trifluoro-2-hydroxy-2-(3-methoxyphenyl)propanoyl]piperidin-4-yl]butylamino]benzamide |
|---|---|
| PubChem CID | 142321203 |
| Molecular Formula | C27H33ClF3N3O4 |
| Molecular Weight | 556.03 g/mol |
| Exact Mass | 555.21 |
| IUPAC Name | 2-chloro-N-methyl-4-[4-[1-[(2R)-3,3,3-trifluoro-2-hydroxy-2-(3-methoxyphenyl)propanoyl]piperidin-4-yl]butylamino]benzamide |
| SMILES | CNC(=O)c1ccc(NCCCCC2CCN(C(=O)[C@](O)(c3cccc(OC)c3)C(F)(F)F)CC2)cc1Cl |
| InChI | InChI=1S/C27H33ClF3N3O4/c1-32-24(35)22-10-9-20(17-23(22)28)33-13-4-3-6-18-11-14-34(15-12-18)25(36)26(37,27(29,30)31)19-7-5-8-21(16-19)38-2/h5,7-10,16-18,33,37H,3-4,6,11-15H2,1-2H3,(H,32,35)/t26-/m1/s1 |
| InChIKey | HAFMFRLQIWJDDV-AREMUKBSSA-N |
| XLogP | 4.98 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.03 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|