About 4-[4-(1-acetylpiperidin-4-yl)butoxy]-2-chloro-N-methylbenzamide;3-methoxyphenol
4-[4-(1-acetylpiperidin-4-yl)butoxy]-2-chloro-N-methylbenzamide;3-methoxyphenol (PubChem CID 142321091) has the molecular formula C26H35ClN2O5
and a molecular weight of 491.03 g/mol. Its IUPAC name is 4-[4-(1-acetylpiperidin-4-yl)butoxy]-2-chloro-N-methylbenzamide;3-methoxyphenol.
Molecular Properties
| Compound Name | 4-[4-(1-acetylpiperidin-4-yl)butoxy]-2-chloro-N-methylbenzamide;3-methoxyphenol |
| PubChem CID | 142321091 |
| Molecular Formula | C26H35ClN2O5 |
| Molecular Weight | 491.03 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 4-[4-(1-acetylpiperidin-4-yl)butoxy]-2-chloro-N-methylbenzamide;3-methoxyphenol |
| SMILES | CNC(=O)c1ccc(OCCCCC2CCN(C(C)=O)CC2)cc1Cl.COc1cccc(O)c1 |
| InChI | InChI=1S/C19H27ClN2O3.C7H8O2/c1-14(23)22-10-8-15(9-11-22)5-3-4-12-25-16-6-7-17(18(20)13-16)19(24)21-2;1-9-7-4-2-3-6(8)5-7/h6-7,13,15H,3-5,8-12H2,1-2H3,(H,21,24);2-5,8H,1H3 |
| InChIKey | ORQREMYXKMELIR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 491.03 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(1-acetylpiperidin-4-yl)butoxy]-2-chloro-N-methylbenzamide;3-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(1-acetylpiperidin-4-yl)butoxy]-2-chloro-N-methylbenzamide;3-methoxyphenol?
The IUPAC name of 4-[4-(1-acetylpiperidin-4-yl)butoxy]-2-chloro-N-methylbenzamide;3-methoxyphenol (CID 142321091) is 4-[4-(1-acetylpiperidin-4-yl)butoxy]-2-chloro-N-methylbenzamide;3-methoxyphenol.
What is the SMILES notation for 4-[4-(1-acetylpiperidin-4-yl)butoxy]-2-chloro-N-methylbenzamide;3-methoxyphenol?
The canonical SMILES for 4-[4-(1-acetylpiperidin-4-yl)butoxy]-2-chloro-N-methylbenzamide;3-methoxyphenol is CNC(=O)c1ccc(OCCCCC2CCN(C(C)=O)CC2)cc1Cl.COc1cccc(O)c1.
What is the InChIKey of 4-[4-(1-acetylpiperidin-4-yl)butoxy]-2-chloro-N-methylbenzamide;3-methoxyphenol?
The InChIKey is ORQREMYXKMELIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27ClN2O3.C7H8O2/c1-14(23)22-10-8-15(9-11-22)5-3-4-12-25-16-6-7-17(18(20)13-16)19(24)21-2;1-9-7-4-2-3-6(8)5-7/h6-7,13,15H,3-5,8-12H2,1-2H3,(H,21,24);2-5,8H,1H3.
What are the key properties of 4-[4-(1-acetylpiperidin-4-yl)butoxy]-2-chloro-N-methylbenzamide;3-methoxyphenol?
4-[4-(1-acetylpiperidin-4-yl)butoxy]-2-chloro-N-methylbenzamide;3-methoxyphenol has a molecular weight of 491.03 g/mol, XLogP of 4.91, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(1-acetylpiperidin-4-yl)butoxy]-2-chloro-N-methylbenzamide;3-methoxyphenol is sourced from PubChem (CID 142321091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).