C26H35ClN2O5 — CID 142321091
4-[4-(1-acetylpiperidin-4-yl)butoxy]-2-chloro-N-methylbenzamide;3-methoxyphenol (PubChem CID 142321091) has the molecular formula C26H35ClN2O5 and a molecular weight of 491.03 g/mol. Its IUPAC name is 4-[4-(1-acetylpiperidin-4-yl)butoxy]-2-chloro-N-methylbenzamide;3-methoxyphenol.
| Compound Name | 4-[4-(1-acetylpiperidin-4-yl)butoxy]-2-chloro-N-methylbenzamide;3-methoxyphenol |
|---|---|
| PubChem CID | 142321091 |
| Molecular Formula | C26H35ClN2O5 |
| Molecular Weight | 491.03 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 4-[4-(1-acetylpiperidin-4-yl)butoxy]-2-chloro-N-methylbenzamide;3-methoxyphenol |
| SMILES | CNC(=O)c1ccc(OCCCCC2CCN(C(C)=O)CC2)cc1Cl.COc1cccc(O)c1 |
| InChI | InChI=1S/C19H27ClN2O3.C7H8O2/c1-14(23)22-10-8-15(9-11-22)5-3-4-12-25-16-6-7-17(18(20)13-16)19(24)21-2;1-9-7-4-2-3-6(8)5-7/h6-7,13,15H,3-5,8-12H2,1-2H3,(H,21,24);2-5,8H,1H3 |
| InChIKey | ORQREMYXKMELIR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.03 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|