C29H36ClF3N2O4 — CID 134434085
2-chloro-N,N-dimethyl-4-[4-[1-[4,4,4-trifluoro-3-(3-methoxyphenyl)butanoyl]piperidin-4-yl]butoxy]benzamide (PubChem CID 134434085) has the molecular formula C29H36ClF3N2O4 and a molecular weight of 569.06 g/mol. Its IUPAC name is 2-chloro-N,N-dimethyl-4-[4-[1-[4,4,4-trifluoro-3-(3-methoxyphenyl)butanoyl]piperidin-4-yl]butoxy]benzamide.
| Compound Name | 2-chloro-N,N-dimethyl-4-[4-[1-[4,4,4-trifluoro-3-(3-methoxyphenyl)butanoyl]piperidin-4-yl]butoxy]benzamide |
|---|---|
| PubChem CID | 134434085 |
| Molecular Formula | C29H36ClF3N2O4 |
| Molecular Weight | 569.06 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | 2-chloro-N,N-dimethyl-4-[4-[1-[4,4,4-trifluoro-3-(3-methoxyphenyl)butanoyl]piperidin-4-yl]butoxy]benzamide |
| SMILES | COc1cccc(C(CC(=O)N2CCC(CCCCOc3ccc(C(=O)N(C)C)c(Cl)c3)CC2)C(F)(F)F)c1 |
| InChI | InChI=1S/C29H36ClF3N2O4/c1-34(2)28(37)24-11-10-23(18-26(24)30)39-16-5-4-7-20-12-14-35(15-13-20)27(36)19-25(29(31,32)33)21-8-6-9-22(17-21)38-3/h6,8-11,17-18,20,25H,4-5,7,12-16,19H2,1-3H3 |
| InChIKey | WHFGFPZSKHEIGX-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.06 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|