C20H26ClF3N2O3 — CID 155039598
2-chloro-N,N-dimethyl-4-[4-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]butoxy]benzamide (PubChem CID 155039598) has the molecular formula C20H26ClF3N2O3 and a molecular weight of 434.89 g/mol. Its IUPAC name is 2-chloro-N,N-dimethyl-4-[4-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]butoxy]benzamide.
| Compound Name | 2-chloro-N,N-dimethyl-4-[4-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]butoxy]benzamide |
|---|---|
| PubChem CID | 155039598 |
| Molecular Formula | C20H26ClF3N2O3 |
| Molecular Weight | 434.89 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 2-chloro-N,N-dimethyl-4-[4-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]butoxy]benzamide |
| SMILES | CN(C)C(=O)c1ccc(OCCCCC2CCN(C(=O)C(F)(F)F)CC2)cc1Cl |
| InChI | InChI=1S/C20H26ClF3N2O3/c1-25(2)18(27)16-7-6-15(13-17(16)21)29-12-4-3-5-14-8-10-26(11-9-14)19(28)20(22,23)24/h6-7,13-14H,3-5,8-12H2,1-2H3 |
| InChIKey | IHPHJCNTBYSUBP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.89 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|