C28H34ClF3N2O4 — CID 134427316
2-chloro-N,N-dimethyl-4-[(4S)-4-[1-(3,3,3-trifluoro-2-hydroxy-2-phenylpropanoyl)piperidin-4-yl]pentoxy]benzamide (PubChem CID 134427316) has the molecular formula C28H34ClF3N2O4 and a molecular weight of 555.04 g/mol. Its IUPAC name is 2-chloro-N,N-dimethyl-4-[(4S)-4-[1-(3,3,3-trifluoro-2-hydroxy-2-phenylpropanoyl)piperidin-4-yl]pentoxy]benzamide.
| Compound Name | 2-chloro-N,N-dimethyl-4-[(4S)-4-[1-(3,3,3-trifluoro-2-hydroxy-2-phenylpropanoyl)piperidin-4-yl]pentoxy]benzamide |
|---|---|
| PubChem CID | 134427316 |
| Molecular Formula | C28H34ClF3N2O4 |
| Molecular Weight | 555.04 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | 2-chloro-N,N-dimethyl-4-[(4S)-4-[1-(3,3,3-trifluoro-2-hydroxy-2-phenylpropanoyl)piperidin-4-yl]pentoxy]benzamide |
| SMILES | C[C@@H](CCCOc1ccc(C(=O)N(C)C)c(Cl)c1)C1CCN(C(=O)C(O)(c2ccccc2)C(F)(F)F)CC1 |
| InChI | InChI=1S/C28H34ClF3N2O4/c1-19(8-7-17-38-22-11-12-23(24(29)18-22)25(35)33(2)3)20-13-15-34(16-14-20)26(36)27(37,28(30,31)32)21-9-5-4-6-10-21/h4-6,9-12,18-20,37H,7-8,13-17H2,1-3H3/t19-,27?/m0/s1 |
| InChIKey | UEORQGCXKYPLOA-JDEXWRGDSA-N |
| XLogP | 5.53 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.04 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|